C17H24N4O2 — CID 165381985
tert-butyl 6-amino-3-piperidin-4-ylindazole-1-carboxylate (PubChem CID 165381985) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is tert-butyl 6-amino-3-piperidin-4-ylindazole-1-carboxylate.
| Compound Name | tert-butyl 6-amino-3-piperidin-4-ylindazole-1-carboxylate |
|---|---|
| PubChem CID | 165381985 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl 6-amino-3-piperidin-4-ylindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(C2CCNCC2)c2ccc(N)cc21 |
| InChI | InChI=1S/C17H24N4O2/c1-17(2,3)23-16(22)21-14-10-12(18)4-5-13(14)15(20-21)11-6-8-19-9-7-11/h4-5,10-11,19H,6-9,18H2,1-3H3 |
| InChIKey | GSZIWETZEDMHFB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|