C18H26N4O2 — CID 76846195
tert-butyl 6-amino-3-(piperidin-1-ylmethyl)indazole-1-carboxylate (PubChem CID 76846195) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 6-amino-3-(piperidin-1-ylmethyl)indazole-1-carboxylate.
| Compound Name | tert-butyl 6-amino-3-(piperidin-1-ylmethyl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 76846195 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | tert-butyl 6-amino-3-(piperidin-1-ylmethyl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(CN2CCCCC2)c2ccc(N)cc21 |
| InChI | InChI=1S/C18H26N4O2/c1-18(2,3)24-17(23)22-16-11-13(19)7-8-14(16)15(20-22)12-21-9-5-4-6-10-21/h7-8,11H,4-6,9-10,12,19H2,1-3H3 |
| InChIKey | VPCIQSPRXQDELL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|