C17H23N3O4 — CID 135929578
tert-butyl 3-[3-(dimethylamino)-3-oxopropyl]-6-hydroxyindazole-1-carboxylate (PubChem CID 135929578) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is tert-butyl 3-[3-(dimethylamino)-3-oxopropyl]-6-hydroxyindazole-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(dimethylamino)-3-oxopropyl]-6-hydroxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 135929578 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | tert-butyl 3-[3-(dimethylamino)-3-oxopropyl]-6-hydroxyindazole-1-carboxylate |
| SMILES | CN(C)C(=O)CCc1nn(C(=O)OC(C)(C)C)c2cc(O)ccc12 |
| InChI | InChI=1S/C17H23N3O4/c1-17(2,3)24-16(23)20-14-10-11(21)6-7-12(14)13(18-20)8-9-15(22)19(4)5/h6-7,10,21H,8-9H2,1-5H3 |
| InChIKey | FEFTZXFYIKZAJP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |