C14H17BrN2O2 — CID 174529401
tert-butyl 3-(2-bromoethyl)indazole-1-carboxylate (PubChem CID 174529401) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is tert-butyl 3-(2-bromoethyl)indazole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-bromoethyl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 174529401 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | tert-butyl 3-(2-bromoethyl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(CCBr)c2ccccc21 |
| InChI | InChI=1S/C14H17BrN2O2/c1-14(2,3)19-13(18)17-12-7-5-4-6-10(12)11(16-17)8-9-15/h4-7H,8-9H2,1-3H3 |
| InChIKey | GUXCUKXZMSKPBN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|