C29H33BrN2O3Si — CID 139994627
tert-butyl 3-(bromomethyl)-4-[tert-butyl(diphenyl)silyl]oxyindazole-1-carboxylate (PubChem CID 139994627) has the molecular formula C29H33BrN2O3Si and a molecular weight of 565.58 g/mol. Its IUPAC name is tert-butyl 3-(bromomethyl)-4-[tert-butyl(diphenyl)silyl]oxyindazole-1-carboxylate.
| Compound Name | tert-butyl 3-(bromomethyl)-4-[tert-butyl(diphenyl)silyl]oxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 139994627 |
| Molecular Formula | C29H33BrN2O3Si |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | tert-butyl 3-(bromomethyl)-4-[tert-butyl(diphenyl)silyl]oxyindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(CBr)c2c(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cccc21 |
| InChI | InChI=1S/C29H33BrN2O3Si/c1-28(2,3)34-27(33)32-24-18-13-19-25(26(24)23(20-30)31-32)35-36(29(4,5)6,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-19H,20H2,1-6H3 |
| InChIKey | QWXUTGFUZHWBDX-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|