C18H19ClN2O5S2 — CID 58054402
tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazole-1-carboxylate (PubChem CID 58054402) has the molecular formula C18H19ClN2O5S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 58054402 |
| Molecular Formula | C18H19ClN2O5S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazole-1-carboxylate |
| SMILES | COc1cccc2c1c(CS(=O)(=O)c1ccc(Cl)s1)nn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H19ClN2O5S2/c1-18(2,3)26-17(22)21-12-6-5-7-13(25-4)16(12)11(20-21)10-28(23,24)15-9-8-14(19)27-15/h5-9H,10H2,1-4H3 |
| InChIKey | GYNRRTFNJAVVPE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |