C25H24ClN3O5S2 — CID 58054538
5-[3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]phenyl]-3-oxopentanamide (PubChem CID 58054538) has the molecular formula C25H24ClN3O5S2 and a molecular weight of 546.07 g/mol. Its IUPAC name is 5-[3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]phenyl]-3-oxopentanamide.
| Compound Name | 5-[3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]phenyl]-3-oxopentanamide |
|---|---|
| PubChem CID | 58054538 |
| Molecular Formula | C25H24ClN3O5S2 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 5-[3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]phenyl]-3-oxopentanamide |
| SMILES | COc1cccc2c1c(CS(=O)(=O)c1ccc(Cl)s1)nn2Cc1cccc(CCC(=O)CC(N)=O)c1 |
| InChI | InChI=1S/C25H24ClN3O5S2/c1-34-21-7-3-6-20-25(21)19(15-36(32,33)24-11-10-22(26)35-24)28-29(20)14-17-5-2-4-16(12-17)8-9-18(30)13-23(27)31/h2-7,10-12H,8-9,13-15H2,1H3,(H2,27,31) |
| InChIKey | ILNHWDZQSNACSH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|