C21H18ClN3O4S2 — CID 58054547
3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]benzamide (PubChem CID 58054547) has the molecular formula C21H18ClN3O4S2 and a molecular weight of 475.98 g/mol. Its IUPAC name is 3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]benzamide.
| Compound Name | 3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 58054547 |
| Molecular Formula | C21H18ClN3O4S2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 3-[[3-[(5-chlorothiophen-2-yl)sulfonylmethyl]-4-methoxyindazol-1-yl]methyl]benzamide |
| SMILES | COc1cccc2c1c(CS(=O)(=O)c1ccc(Cl)s1)nn2Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C21H18ClN3O4S2/c1-29-17-7-3-6-16-20(17)15(12-31(27,28)19-9-8-18(22)30-19)24-25(16)11-13-4-2-5-14(10-13)21(23)26/h2-10H,11-12H2,1H3,(H2,23,26) |
| InChIKey | QHCHASDKXSOSSA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |