C23H32ClN3O6S2Si — CID 58054494
tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonyl-(2-trimethylsilylethoxymethyl)amino]-4-methoxyindazole-1-carboxylate (PubChem CID 58054494) has the molecular formula C23H32ClN3O6S2Si and a molecular weight of 574.20 g/mol. Its IUPAC name is tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonyl-(2-trimethylsilylethoxymethyl)amino]-4-methoxyindazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonyl-(2-trimethylsilylethoxymethyl)amino]-4-methoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 58054494 |
| Molecular Formula | C23H32ClN3O6S2Si |
| Molecular Weight | 574.20 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | tert-butyl 3-[(5-chlorothiophen-2-yl)sulfonyl-(2-trimethylsilylethoxymethyl)amino]-4-methoxyindazole-1-carboxylate |
| SMILES | COc1cccc2c1c(N(COCC[Si](C)(C)C)S(=O)(=O)c1ccc(Cl)s1)nn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32ClN3O6S2Si/c1-23(2,3)33-22(28)27-16-9-8-10-17(31-4)20(16)21(25-27)26(15-32-13-14-36(5,6)7)35(29,30)19-12-11-18(24)34-19/h8-12H,13-15H2,1-7H3 |
| InChIKey | LEUKUHMRKQVARJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.20 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|