C27H36N2O5 — CID 159534403
tert-butyl 4-[(2S)-2-hydroxy-7-(2-methoxyphenyl)heptoxy]-3-methylindazole-1-carboxylate (PubChem CID 159534403) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-2-hydroxy-7-(2-methoxyphenyl)heptoxy]-3-methylindazole-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-2-hydroxy-7-(2-methoxyphenyl)heptoxy]-3-methylindazole-1-carboxylate |
|---|---|
| PubChem CID | 159534403 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | tert-butyl 4-[(2S)-2-hydroxy-7-(2-methoxyphenyl)heptoxy]-3-methylindazole-1-carboxylate |
| SMILES | COc1ccccc1CCCCC[C@H](O)COc1cccc2c1c(C)nn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H36N2O5/c1-19-25-22(29(28-19)26(31)34-27(2,3)4)15-11-17-24(25)33-18-21(30)14-8-6-7-12-20-13-9-10-16-23(20)32-5/h9-11,13,15-17,21,30H,6-8,12,14,18H2,1-5H3/t21-/m0/s1 |
| InChIKey | AUKJHTJOYKAGOV-NRFANRHFSA-N |
| XLogP | 5.68 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|