About CID 174640922
CID 174640922 (PubChem CID 174640922) has the molecular formula C20H27O3Sn
and a molecular weight of 434.14 g/mol.
Molecular Properties
| Compound Name | CID 174640922 |
| PubChem CID | 174640922 |
| Molecular Formula | C20H27O3Sn |
| Molecular Weight | 434.14 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | — |
| SMILES | COc1ccccc1CCc1ccccc1OCC(O)C[Sn](C)C |
| InChI | InChI=1S/C18H21O3.2CH3.Sn/c1-14(19)13-21-18-10-6-4-8-16(18)12-11-15-7-3-5-9-17(15)20-2;;;/h3-10,14,19H,1,11-13H2,2H3;2*1H3; |
| InChIKey | HNGPQZFGMHHLCF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 174640922 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174640922?
The IUPAC name of CID 174640922 (CID 174640922) is not available.
What is the SMILES notation for CID 174640922?
The canonical SMILES for CID 174640922 is COc1ccccc1CCc1ccccc1OCC(O)C[Sn](C)C.
What is the InChIKey of CID 174640922?
The InChIKey is HNGPQZFGMHHLCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21O3.2CH3.Sn/c1-14(19)13-21-18-10-6-4-8-16(18)12-11-15-7-3-5-9-17(15)20-2;;;/h3-10,14,19H,1,11-13H2,2H3;2*1H3;.
What are the key properties of CID 174640922?
CID 174640922 has a molecular weight of 434.14 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174640922 is sourced from PubChem (CID 174640922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).