C19H17ClN2O4 — CID 155410842
tert-butyl 3-(1,3-benzodioxol-5-yl)-4-chloroindazole-1-carboxylate (PubChem CID 155410842) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is tert-butyl 3-(1,3-benzodioxol-5-yl)-4-chloroindazole-1-carboxylate.
| Compound Name | tert-butyl 3-(1,3-benzodioxol-5-yl)-4-chloroindazole-1-carboxylate |
|---|---|
| PubChem CID | 155410842 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | tert-butyl 3-(1,3-benzodioxol-5-yl)-4-chloroindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2ccc3c(c2)OCO3)c2c(Cl)cccc21 |
| InChI | InChI=1S/C19H17ClN2O4/c1-19(2,3)26-18(23)22-13-6-4-5-12(20)16(13)17(21-22)11-7-8-14-15(9-11)25-10-24-14/h4-9H,10H2,1-3H3 |
| InChIKey | QXIHHGQZGLXKCI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |