C23H27ClN2O3 — CID 167772312
tert-butyl 4-chloro-3-[3-[(dimethylamino)methyl]-4-methoxyphenyl]indole-1-carboxylate (PubChem CID 167772312) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is tert-butyl 4-chloro-3-[3-[(dimethylamino)methyl]-4-methoxyphenyl]indole-1-carboxylate.
| Compound Name | tert-butyl 4-chloro-3-[3-[(dimethylamino)methyl]-4-methoxyphenyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 167772312 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | tert-butyl 4-chloro-3-[3-[(dimethylamino)methyl]-4-methoxyphenyl]indole-1-carboxylate |
| SMILES | COc1ccc(-c2cn(C(=O)OC(C)(C)C)c3cccc(Cl)c23)cc1CN(C)C |
| InChI | InChI=1S/C23H27ClN2O3/c1-23(2,3)29-22(27)26-14-17(21-18(24)8-7-9-19(21)26)15-10-11-20(28-6)16(12-15)13-25(4)5/h7-12,14H,13H2,1-6H3 |
| InChIKey | IHSSLHVHFRFHJL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |