C20H20FNO3 — CID 46785701
tert-butyl 3-(3-fluorophenyl)-4-(hydroxymethyl)indole-1-carboxylate (PubChem CID 46785701) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is tert-butyl 3-(3-fluorophenyl)-4-(hydroxymethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(3-fluorophenyl)-4-(hydroxymethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 46785701 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl 3-(3-fluorophenyl)-4-(hydroxymethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2cccc(F)c2)c2c(CO)cccc21 |
| InChI | InChI=1S/C20H20FNO3/c1-20(2,3)25-19(24)22-11-16(13-6-4-8-15(21)10-13)18-14(12-23)7-5-9-17(18)22/h4-11,23H,12H2,1-3H3 |
| InChIKey | ULRHHWGIRSBPFJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |