C14H15ClFNO3 — CID 118084237
tert-butyl 5-chloro-6-fluoro-3-(hydroxymethyl)indole-1-carboxylate (PubChem CID 118084237) has the molecular formula C14H15ClFNO3 and a molecular weight of 299.73 g/mol. Its IUPAC name is tert-butyl 5-chloro-6-fluoro-3-(hydroxymethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-chloro-6-fluoro-3-(hydroxymethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 118084237 |
| Molecular Formula | C14H15ClFNO3 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | tert-butyl 5-chloro-6-fluoro-3-(hydroxymethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CO)c2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C14H15ClFNO3/c1-14(2,3)20-13(19)17-6-8(7-18)9-4-10(15)11(16)5-12(9)17/h4-6,18H,7H2,1-3H3 |
| InChIKey | WZZJRBZAPFIVMN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |