C15H15ClF3NO2 — CID 118084213
tert-butyl 3-(chloromethyl)-5-(trifluoromethyl)indole-1-carboxylate (PubChem CID 118084213) has the molecular formula C15H15ClF3NO2 and a molecular weight of 333.74 g/mol. Its IUPAC name is tert-butyl 3-(chloromethyl)-5-(trifluoromethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(chloromethyl)-5-(trifluoromethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 118084213 |
| Molecular Formula | C15H15ClF3NO2 |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | tert-butyl 3-(chloromethyl)-5-(trifluoromethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CCl)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H15ClF3NO2/c1-14(2,3)22-13(21)20-8-9(7-16)11-6-10(15(17,18)19)4-5-12(11)20/h4-6,8H,7H2,1-3H3 |
| InChIKey | WULDSMOOPAWZTE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|