C14H15Cl2NO3 — CID 150385498
tert-butyl 4,5-dichloro-3-(hydroxymethyl)indole-1-carboxylate (PubChem CID 150385498) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is tert-butyl 4,5-dichloro-3-(hydroxymethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 4,5-dichloro-3-(hydroxymethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 150385498 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | tert-butyl 4,5-dichloro-3-(hydroxymethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CO)c2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C14H15Cl2NO3/c1-14(2,3)20-13(19)17-6-8(7-18)11-10(17)5-4-9(15)12(11)16/h4-6,18H,7H2,1-3H3 |
| InChIKey | HAPPFKVZBJMHOY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |