C12H12Cl2N2O2 — CID 69432928
tert-butyl 6,7-dichlorobenzimidazole-1-carboxylate (PubChem CID 69432928) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is tert-butyl 6,7-dichlorobenzimidazole-1-carboxylate.
| Compound Name | tert-butyl 6,7-dichlorobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 69432928 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | tert-butyl 6,7-dichlorobenzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C12H12Cl2N2O2/c1-12(2,3)18-11(17)16-6-15-8-5-4-7(13)9(14)10(8)16/h4-6H,1-3H3 |
| InChIKey | UXAKJPXQHBBDFB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |