C13H16N2O2 — CID 59283343
tert-butyl 6-methylbenzimidazole-1-carboxylate (PubChem CID 59283343) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl 6-methylbenzimidazole-1-carboxylate.
| Compound Name | tert-butyl 6-methylbenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 59283343 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | tert-butyl 6-methylbenzimidazole-1-carboxylate |
| SMILES | Cc1ccc2ncn(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C13H16N2O2/c1-9-5-6-10-11(7-9)15(8-14-10)12(16)17-13(2,3)4/h5-8H,1-4H3 |
| InChIKey | DSEXPSOZXKKEQC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |