C26H28N4O6 — CID 161032302
tert-butyl 5-formylbenzimidazole-1-carboxylate;tert-butyl 6-formylbenzimidazole-1-carboxylate (PubChem CID 161032302) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is tert-butyl 5-formylbenzimidazole-1-carboxylate;tert-butyl 6-formylbenzimidazole-1-carboxylate.
| Compound Name | tert-butyl 5-formylbenzimidazole-1-carboxylate;tert-butyl 6-formylbenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 161032302 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | tert-butyl 5-formylbenzimidazole-1-carboxylate;tert-butyl 6-formylbenzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc2cc(C=O)ccc21.CC(C)(C)OC(=O)n1cnc2ccc(C=O)cc21 |
| InChI | InChI=1S/2C13H14N2O3/c1-13(2,3)18-12(17)15-8-14-10-6-9(7-16)4-5-11(10)15;1-13(2,3)18-12(17)15-8-14-10-5-4-9(7-16)6-11(10)15/h2*4-8H,1-3H3 |
| InChIKey | TZTXTXWOZZASAP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 122.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|