C15H17N7O2 — CID 172979395
tert-butyl 5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzimidazole-1-carboxylate (PubChem CID 172979395) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is tert-butyl 5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 172979395 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | tert-butyl 5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzimidazole-1-carboxylate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2c(c1)ncn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H17N7O2/c1-15(2,3)24-14(23)22-8-19-10-6-9(4-5-12(10)22)20-21-11(7-16)13(17)18/h4-6,8,20H,1-3H3,(H3,17,18)/b21-11+ |
| InChIKey | VELLWVGBGFEEEJ-SRZZPIQSSA-N |
| XLogP | 2.05 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|