C18H24N6O2 — CID 172977016
tert-butyl 6-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,3-dimethyl-2H-indole-1-carboxylate (PubChem CID 172977016) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is tert-butyl 6-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,3-dimethyl-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 6-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,3-dimethyl-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 172977016 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | tert-butyl 6-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,3-dimethyl-2H-indole-1-carboxylate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2c(c1)N(C(=O)OC(C)(C)C)CC2(C)C |
| InChI | InChI=1S/C18H24N6O2/c1-17(2,3)26-16(25)24-10-18(4,5)12-7-6-11(8-14(12)24)22-23-13(9-19)15(20)21/h6-8,22H,10H2,1-5H3,(H3,20,21)/b23-13+ |
| InChIKey | NXLHIEMWSIODST-YDZHTSKRSA-N |
| XLogP | 2.95 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|