C12H13N5O — CID 172979749
(1Z)-2-amino-N-[(2-hydroxy-2,3-dihydro-1H-inden-5-yl)amino]-2-iminoethanimidoyl cyanide (PubChem CID 172979749) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is (1Z)-2-amino-N-[(2-hydroxy-2,3-dihydro-1H-inden-5-yl)amino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[(2-hydroxy-2,3-dihydro-1H-inden-5-yl)amino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979749 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (1Z)-2-amino-N-[(2-hydroxy-2,3-dihydro-1H-inden-5-yl)amino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2c(c1)CC(O)C2 |
| InChI | InChI=1S/C12H13N5O/c13-6-11(12(14)15)17-16-9-2-1-7-4-10(18)5-8(7)3-9/h1-3,10,16,18H,4-5H2,(H3,14,15)/b17-11+ |
| InChIKey | XLPYHRDYIGGKEG-GZTJUZNOSA-N |
| XLogP | 0.37 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|