C12H14N6O2S — CID 172977067
(1Z)-2-amino-N-[4-(cyclopropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172977067) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-(cyclopropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-(cyclopropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977067 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (1Z)-2-amino-N-[4-(cyclopropylsulfamoyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C12H14N6O2S/c13-7-11(12(14)15)17-16-8-3-5-10(6-4-8)21(19,20)18-9-1-2-9/h3-6,9,16,18H,1-2H2,(H3,14,15)/b17-11+ |
| InChIKey | VXZNQOAPGWBIGN-GZTJUZNOSA-N |
| XLogP | 0.35 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|