C16H15N3O4S2 — CID 24602920
4-cyano-N-[4-(cyclopropylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 24602920) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-cyano-N-[4-(cyclopropylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[4-(cyclopropylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24602920 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-cyano-N-[4-(cyclopropylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)NC3CC3)cc2)cc1 |
| InChI | InChI=1S/C16H15N3O4S2/c17-11-12-1-7-15(8-2-12)24(20,21)19-14-5-9-16(10-6-14)25(22,23)18-13-3-4-13/h1-2,5-10,13,18-19H,3-4H2 |
| InChIKey | FLYXJIUYHJQRNZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |