C13H15N7O4S — CID 172976222
(1Z)-2-amino-N-[5-(cyclopropylsulfamoyl)-2-methyl-3-nitroanilino]-2-iminoethanimidoyl cyanide (PubChem CID 172976222) has the molecular formula C13H15N7O4S and a molecular weight of 365.38 g/mol. Its IUPAC name is (1Z)-2-amino-N-[5-(cyclopropylsulfamoyl)-2-methyl-3-nitroanilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[5-(cyclopropylsulfamoyl)-2-methyl-3-nitroanilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976222 |
| Molecular Formula | C13H15N7O4S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (1Z)-2-amino-N-[5-(cyclopropylsulfamoyl)-2-methyl-3-nitroanilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(S(=O)(=O)NC2CC2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H15N7O4S/c1-7-10(17-18-11(6-14)13(15)16)4-9(5-12(7)20(21)22)25(23,24)19-8-2-3-8/h4-5,8,17,19H,2-3H2,1H3,(H3,15,16)/b18-11+ |
| InChIKey | FJPRAZHYYYVEFQ-WOJGMQOQSA-N |
| XLogP | 0.57 |
| TPSA | 187.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|