C10H9N7O2S — CID 172980313
(1Z)-2-amino-N-(2-carbamothioyl-4-nitroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172980313) has the molecular formula C10H9N7O2S and a molecular weight of 291.30 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2-carbamothioyl-4-nitroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2-carbamothioyl-4-nitroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172980313 |
| Molecular Formula | C10H9N7O2S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (1Z)-2-amino-N-(2-carbamothioyl-4-nitroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc([N+](=O)[O-])cc1C(N)=S |
| InChI | InChI=1S/C10H9N7O2S/c11-4-8(9(12)13)16-15-7-2-1-5(17(18)19)3-6(7)10(14)20/h1-3,15H,(H3,12,13)(H2,14,20)/b16-8+ |
| InChIKey | CSVMKDYGQPNBLY-LZYBPNLTSA-N |
| XLogP | 0.46 |
| TPSA | 167.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|