C11H9IN6O4 — CID 172977678
methyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-iodo-5-nitrobenzoate (PubChem CID 172977678) has the molecular formula C11H9IN6O4 and a molecular weight of 416.14 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-iodo-5-nitrobenzoate.
| Compound Name | methyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-iodo-5-nitrobenzoate |
|---|---|
| PubChem CID | 172977678 |
| Molecular Formula | C11H9IN6O4 |
| Molecular Weight | 416.14 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | methyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-iodo-5-nitrobenzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(I)cc([N+](=O)[O-])cc1C(=O)OC |
| InChI | InChI=1S/C11H9IN6O4/c1-22-11(19)6-2-5(18(20)21)3-7(12)9(6)17-16-8(4-13)10(14)15/h2-3,17H,1H3,(H3,14,15)/b16-8+ |
| InChIKey | LQYBTTUGFMEROX-LZYBPNLTSA-N |
| XLogP | 1.21 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.14 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|