C12H11F2N5O2 — CID 172976485
ethyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,5-difluorobenzoate (PubChem CID 172976485) has the molecular formula C12H11F2N5O2 and a molecular weight of 295.25 g/mol. Its IUPAC name is ethyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,5-difluorobenzoate.
| Compound Name | ethyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 172976485 |
| Molecular Formula | C12H11F2N5O2 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | ethyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3,5-difluorobenzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(F)cc(C(=O)OCC)cc1F |
| InChI | InChI=1S/C12H11F2N5O2/c1-2-21-12(20)6-3-7(13)10(8(14)4-6)19-18-9(5-15)11(16)17/h3-4,19H,2H2,1H3,(H3,16,17)/b18-9+ |
| InChIKey | DFJXLECHSGGJSP-GIJQJNRQSA-N |
| XLogP | 1.37 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|