C10H9FN6O2 — CID 172978164
(1Z)-2-amino-N-(2-fluoro-6-methyl-4-nitroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172978164) has the molecular formula C10H9FN6O2 and a molecular weight of 264.22 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2-fluoro-6-methyl-4-nitroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2-fluoro-6-methyl-4-nitroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978164 |
| Molecular Formula | C10H9FN6O2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (1Z)-2-amino-N-(2-fluoro-6-methyl-4-nitroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(C)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H9FN6O2/c1-5-2-6(17(18)19)3-7(11)9(5)16-15-8(4-12)10(13)14/h2-3,16H,1H3,(H3,13,14)/b15-8+ |
| InChIKey | XHQYKYUGQVWXTB-OVCLIPMQSA-N |
| XLogP | 1.27 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|