C13H15BrN6O2 — CID 172976376
(1Z)-2-amino-N-(2-bromo-4-tert-butyl-6-nitroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172976376) has the molecular formula C13H15BrN6O2 and a molecular weight of 367.21 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2-bromo-4-tert-butyl-6-nitroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2-bromo-4-tert-butyl-6-nitroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976376 |
| Molecular Formula | C13H15BrN6O2 |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (1Z)-2-amino-N-(2-bromo-4-tert-butyl-6-nitroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Br)cc(C(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15BrN6O2/c1-13(2,3)7-4-8(14)11(10(5-7)20(21)22)19-18-9(6-15)12(16)17/h4-5,19H,1-3H3,(H3,16,17)/b18-9+ |
| InChIKey | HPIJDOKRRQYOMJ-GIJQJNRQSA-N |
| XLogP | 2.88 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|