C9H7IN6O2 — CID 172978847
(1Z)-2-amino-2-imino-N-(2-iodo-6-nitroanilino)ethanimidoyl cyanide (PubChem CID 172978847) has the molecular formula C9H7IN6O2 and a molecular weight of 358.10 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-(2-iodo-6-nitroanilino)ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-(2-iodo-6-nitroanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978847 |
| Molecular Formula | C9H7IN6O2 |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-(2-iodo-6-nitroanilino)ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(I)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7IN6O2/c10-5-2-1-3-7(16(17)18)8(5)15-14-6(4-11)9(12)13/h1-3,15H,(H3,12,13)/b14-6+ |
| InChIKey | RGAAXJLMLRGXLC-MKMNVTDBSA-N |
| XLogP | 1.43 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|