C14H14N6 — CID 172976751
(1Z)-2-amino-N-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-2-iminoethanimidoyl cyanide (PubChem CID 172976751) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976751 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1Z)-2-amino-N-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(C)cc(C=CC#N)cc1C |
| InChI | InChI=1S/C14H14N6/c1-9-6-11(4-3-5-15)7-10(2)13(9)20-19-12(8-16)14(17)18/h3-4,6-7,20H,1-2H3,(H3,17,18)/b4-3?,19-12+ |
| InChIKey | BMKLOOFUCUPATR-ROVUFHOZSA-N |
| XLogP | 2.07 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|