C12H13N5O2 — CID 172931597
methyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-methylbenzoate (PubChem CID 172931597) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is methyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-methylbenzoate.
| Compound Name | methyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 172931597 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | methyl 4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-3-methylbenzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(C(=O)OC)cc1C |
| InChI | InChI=1S/C12H13N5O2/c1-7-5-8(12(18)19-2)3-4-9(7)16-17-10(6-13)11(14)15/h3-5,16H,1-2H3,(H3,14,15)/b17-10+ |
| InChIKey | WPZFMAKMXLDVBC-LICLKQGHSA-N |
| XLogP | 1.01 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|