C11H11ClN6O — CID 172976257
(1Z)-2-amino-N-[2-chloro-5-(methylcarbamoyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172976257) has the molecular formula C11H11ClN6O and a molecular weight of 278.70 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2-chloro-5-(methylcarbamoyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2-chloro-5-(methylcarbamoyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976257 |
| Molecular Formula | C11H11ClN6O |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (1Z)-2-amino-N-[2-chloro-5-(methylcarbamoyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(C(=O)NC)ccc1Cl |
| InChI | InChI=1S/C11H11ClN6O/c1-16-11(19)6-2-3-7(12)8(4-6)17-18-9(5-13)10(14)15/h2-4,17H,1H3,(H3,14,15)(H,16,19)/b18-9+ |
| InChIKey | FGXWFTPYJXKLPW-GIJQJNRQSA-N |
| XLogP | 0.93 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|