C14H18N6O2 — CID 172976444
methyl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-(propan-2-ylamino)benzoate (PubChem CID 172976444) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is methyl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-(propan-2-ylamino)benzoate.
| Compound Name | methyl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-(propan-2-ylamino)benzoate |
|---|---|
| PubChem CID | 172976444 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | methyl 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-(propan-2-ylamino)benzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(C(=O)OC)ccc1NC(C)C |
| InChI | InChI=1S/C14H18N6O2/c1-8(2)18-10-5-4-9(14(21)22-3)6-11(10)19-20-12(7-15)13(16)17/h4-6,8,18-19H,1-3H3,(H3,16,17)/b20-12+ |
| InChIKey | KCAVTQMOLKJIAE-UDWIEESQSA-N |
| XLogP | 1.52 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|