C19H14N6O4 — CID 172976151
methyl 4-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 172976151) has the molecular formula C19H14N6O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is methyl 4-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 172976151 |
| Molecular Formula | C19H14N6O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | methyl 4-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2c(c1)C(=O)N(c1ccc(C(=O)OC)cc1)C2=O |
| InChI | InChI=1S/C19H14N6O4/c1-29-19(28)10-2-5-12(6-3-10)25-17(26)13-7-4-11(8-14(13)18(25)27)23-24-15(9-20)16(21)22/h2-8,23H,1H3,(H3,21,22)/b24-15+ |
| InChIKey | IHHMGLIOXMICPI-BUVRLJJBSA-N |
| XLogP | 1.50 |
| TPSA | 161.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|