C13H15ClN6O — CID 172980104
(1Z)-2-amino-N-(2-chloro-5-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172980104) has the molecular formula C13H15ClN6O and a molecular weight of 306.76 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2-chloro-5-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2-chloro-5-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172980104 |
| Molecular Formula | C13H15ClN6O |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (1Z)-2-amino-N-(2-chloro-5-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C13H15ClN6O/c14-10-2-1-9(20-3-5-21-6-4-20)7-11(10)18-19-12(8-15)13(16)17/h1-2,7,18H,3-6H2,(H3,16,17)/b19-12+ |
| InChIKey | YKIDKZRJRJUDMC-XDHOZWIPSA-N |
| XLogP | 1.40 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|