C13H16N6O — CID 172976073
(1Z)-2-amino-2-imino-N-(2-morpholin-4-ylanilino)ethanimidoyl cyanide (PubChem CID 172976073) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-(2-morpholin-4-ylanilino)ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-(2-morpholin-4-ylanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976073 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-(2-morpholin-4-ylanilino)ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C13H16N6O/c14-9-11(13(15)16)18-17-10-3-1-2-4-12(10)19-5-7-20-8-6-19/h1-4,17H,5-8H2,(H3,15,16)/b18-11+ |
| InChIKey | PVBULCGQRHUQBI-WOJGMQOQSA-N |
| XLogP | 0.75 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|