C16H21N7O2 — CID 172976716
(1Z)-2-amino-2-imino-N-[2-(2-morpholin-4-ylethylcarbamoyl)anilino]ethanimidoyl cyanide (PubChem CID 172976716) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[2-(2-morpholin-4-ylethylcarbamoyl)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[2-(2-morpholin-4-ylethylcarbamoyl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976716 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[2-(2-morpholin-4-ylethylcarbamoyl)anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccccc1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H21N7O2/c17-11-14(15(18)19)22-21-13-4-2-1-3-12(13)16(24)20-5-6-23-7-9-25-10-8-23/h1-4,21H,5-10H2,(H3,18,19)(H,20,24)/b22-14+ |
| InChIKey | YURFFZWPRPORHC-HYARGMPZSA-N |
| XLogP | -0.02 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|