C17H21N7O3 — CID 172977826
ethyl 4-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoyl]piperazine-1-carboxylate (PubChem CID 172977826) has the molecular formula C17H21N7O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is ethyl 4-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172977826 |
| Molecular Formula | C17H21N7O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethyl 4-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]benzoyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccccc1C(=O)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H21N7O3/c1-2-27-17(26)24-9-7-23(8-10-24)16(25)12-5-3-4-6-13(12)21-22-14(11-18)15(19)20/h3-6,21H,2,7-10H2,1H3,(H3,19,20)/b22-14+ |
| InChIKey | FGHDSYDYGAPPDC-HYARGMPZSA-N |
| XLogP | 0.83 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|