C18H18N6O — CID 172976713
(1Z)-2-amino-N-[2-[(2,6-dimethylphenyl)carbamoyl]anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172976713) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2-[(2,6-dimethylphenyl)carbamoyl]anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2-[(2,6-dimethylphenyl)carbamoyl]anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976713 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (1Z)-2-amino-N-[2-[(2,6-dimethylphenyl)carbamoyl]anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccccc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H18N6O/c1-11-6-5-7-12(2)16(11)22-18(25)13-8-3-4-9-14(13)23-24-15(10-19)17(20)21/h3-9,23H,1-2H3,(H3,20,21)(H,22,25)/b24-15+ |
| InChIKey | RHKJTSMQLDVRDF-BUVRLJJBSA-N |
| XLogP | 2.78 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|