C22H18N6O2 — CID 172980124
3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(2-phenylanilino)benzoic acid (PubChem CID 172980124) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(2-phenylanilino)benzoic acid.
| Compound Name | 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(2-phenylanilino)benzoic acid |
|---|---|
| PubChem CID | 172980124 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(2-phenylanilino)benzoic acid |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(C(=O)O)c1Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H18N6O2/c23-13-19(21(24)25)28-27-18-12-6-10-16(22(29)30)20(18)26-17-11-5-4-9-15(17)14-7-2-1-3-8-14/h1-12,26-27H,(H3,24,25)(H,29,30)/b28-19+ |
| InChIKey | BOSXYGKGSLNWMI-TURZUDJPSA-N |
| XLogP | 4.02 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|