C15H15N7O2 — CID 172978476
ethyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-pyrazol-1-ylbenzoate (PubChem CID 172978476) has the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. Its IUPAC name is ethyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-pyrazol-1-ylbenzoate.
| Compound Name | ethyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-pyrazol-1-ylbenzoate |
|---|---|
| PubChem CID | 172978476 |
| Molecular Formula | C15H15N7O2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-pyrazol-1-ylbenzoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(-n2cccn2)ccc1C(=O)OCC |
| InChI | InChI=1S/C15H15N7O2/c1-2-24-15(23)11-5-4-10(22-7-3-6-19-22)8-12(11)20-21-13(9-16)14(17)18/h3-8,20H,2H2,1H3,(H3,17,18)/b21-13+ |
| InChIKey | UJBCFGFHVKXVGU-FYJGNVAPSA-N |
| XLogP | 1.28 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|