C14H14BrN5O2 — CID 172976125
ethyl 3-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromophenyl]prop-2-enoate (PubChem CID 172976125) has the molecular formula C14H14BrN5O2 and a molecular weight of 364.20 g/mol. Its IUPAC name is ethyl 3-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromophenyl]prop-2-enoate.
| Compound Name | ethyl 3-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 172976125 |
| Molecular Formula | C14H14BrN5O2 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | ethyl 3-[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-5-bromophenyl]prop-2-enoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(Br)cc1C=CC(=O)OCC |
| InChI | InChI=1S/C14H14BrN5O2/c1-2-22-13(21)6-3-9-7-10(15)4-5-11(9)19-20-12(8-16)14(17)18/h3-7,19H,2H2,1H3,(H3,17,18)/b6-3?,20-12+ |
| InChIKey | FAVDKWNECMFUCQ-BZBRBHDGSA-N |
| XLogP | 2.25 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|