C11H12BrN5O2S — CID 172932086
(1Z)-2-amino-N-(2-bromo-5-ethylsulfonylanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172932086) has the molecular formula C11H12BrN5O2S and a molecular weight of 358.22 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2-bromo-5-ethylsulfonylanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2-bromo-5-ethylsulfonylanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172932086 |
| Molecular Formula | C11H12BrN5O2S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | (1Z)-2-amino-N-(2-bromo-5-ethylsulfonylanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(S(=O)(=O)CC)ccc1Br |
| InChI | InChI=1S/C11H12BrN5O2S/c1-2-20(18,19)7-3-4-8(12)9(5-7)16-17-10(6-13)11(14)15/h3-5,16H,2H2,1H3,(H3,14,15)/b17-10+ |
| InChIKey | AAHGFRPIXUQPRG-LICLKQGHSA-N |
| XLogP | 1.47 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|