C13H17N7 — CID 172976456
(1Z)-2-amino-2-imino-N-(4-piperazin-1-ylanilino)ethanimidoyl cyanide (PubChem CID 172976456) has the molecular formula C13H17N7 and a molecular weight of 271.33 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-(4-piperazin-1-ylanilino)ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-(4-piperazin-1-ylanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976456 |
| Molecular Formula | C13H17N7 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-(4-piperazin-1-ylanilino)ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C13H17N7/c14-9-12(13(15)16)19-18-10-1-3-11(4-2-10)20-7-5-17-6-8-20/h1-4,17-18H,5-8H2,(H3,15,16)/b19-12+ |
| InChIKey | SRRMRFQBPQVLBL-XDHOZWIPSA-N |
| XLogP | 0.32 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|