C13H16N6O2S — CID 172978140
(1Z)-2-amino-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172978140) has the molecular formula C13H16N6O2S and a molecular weight of 320.38 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978140 |
| Molecular Formula | C13H16N6O2S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (1Z)-2-amino-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H16N6O2S/c14-9-12(13(15)16)18-17-10-1-3-11(4-2-10)19-5-7-22(20,21)8-6-19/h1-4,17H,5-8H2,(H3,15,16)/b18-12+ |
| InChIKey | AUHBMYIFJJSNCL-LDADJPATSA-N |
| XLogP | 0.15 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|