C16H21N7O — CID 172977909
(1Z)-N-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-2-amino-2-iminoethanimidoyl cyanide (PubChem CID 172977909) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is (1Z)-N-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-2-amino-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-N-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-2-amino-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977909 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (1Z)-N-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-2-amino-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(N2CCN(C(C)=O)CC2)c(C)c1 |
| InChI | InChI=1S/C16H21N7O/c1-11-9-13(20-21-14(10-17)16(18)19)3-4-15(11)23-7-5-22(6-8-23)12(2)24/h3-4,9,20H,5-8H2,1-2H3,(H3,18,19)/b21-14+ |
| InChIKey | XMPHXGVYWDAWGN-KGENOOAVSA-N |
| XLogP | 0.89 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|