C15H18N8O3 — CID 172977428
(1Z)-2-amino-N-[4-(4-carbamoylpiperidin-1-yl)-3-nitroanilino]-2-iminoethanimidoyl cyanide (PubChem CID 172977428) has the molecular formula C15H18N8O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-(4-carbamoylpiperidin-1-yl)-3-nitroanilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-(4-carbamoylpiperidin-1-yl)-3-nitroanilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977428 |
| Molecular Formula | C15H18N8O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (1Z)-2-amino-N-[4-(4-carbamoylpiperidin-1-yl)-3-nitroanilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(N2CCC(C(N)=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N8O3/c16-8-11(14(17)18)21-20-10-1-2-12(13(7-10)23(25)26)22-5-3-9(4-6-22)15(19)24/h1-2,7,9,20H,3-6H2,(H3,17,18)(H2,19,24)/b21-11+ |
| InChIKey | IWXRNSKCWIWFOU-SRZZPIQSSA-N |
| XLogP | 0.52 |
| TPSA | 187.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|